C25H27N5O3 — CID 157201076
1-[[1-[5-(2-hydroxyacetyl)pyrimidin-2-yl]piperidin-4-yl]methyl]-3-(4-phenylphenyl)urea (PubChem CID 157201076) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[[1-[5-(2-hydroxyacetyl)pyrimidin-2-yl]piperidin-4-yl]methyl]-3-(4-phenylphenyl)urea.
| Compound Name | 1-[[1-[5-(2-hydroxyacetyl)pyrimidin-2-yl]piperidin-4-yl]methyl]-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 157201076 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[[1-[5-(2-hydroxyacetyl)pyrimidin-2-yl]piperidin-4-yl]methyl]-3-(4-phenylphenyl)urea |
| SMILES | O=C(NCC1CCN(c2ncc(C(=O)CO)cn2)CC1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N5O3/c31-17-23(32)21-15-26-24(27-16-21)30-12-10-18(11-13-30)14-28-25(33)29-22-8-6-20(7-9-22)19-4-2-1-3-5-19/h1-9,15-16,18,31H,10-14,17H2,(H2,28,29,33) |
| InChIKey | AQUNQCWBXLRVFT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |