About 3,3-diethylsiletane
3,3-diethylsiletane (PubChem CID 15720725) has the molecular formula C7H16Si
and a molecular weight of 128.29 g/mol. Its IUPAC name is 3,3-diethylsiletane.
Molecular Properties
| Compound Name | 3,3-diethylsiletane |
| PubChem CID | 15720725 |
| Molecular Formula | C7H16Si |
| Molecular Weight | 128.29 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | 3,3-diethylsiletane |
| SMILES | CCC1(CC)C[SiH2]C1 |
| InChI | InChI=1S/C7H16Si/c1-3-7(4-2)5-8-6-7/h3-6,8H2,1-2H3 |
| InChIKey | FCBDKZUWKSSTHD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethylsiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethylsiletane?
The IUPAC name of 3,3-diethylsiletane (CID 15720725) is 3,3-diethylsiletane.
What is the SMILES notation for 3,3-diethylsiletane?
The canonical SMILES for 3,3-diethylsiletane is CCC1(CC)C[SiH2]C1.
What is the InChIKey of 3,3-diethylsiletane?
The InChIKey is FCBDKZUWKSSTHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16Si/c1-3-7(4-2)5-8-6-7/h3-6,8H2,1-2H3.
What are the key properties of 3,3-diethylsiletane?
3,3-diethylsiletane has a molecular weight of 128.29 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethylsiletane is sourced from PubChem (CID 15720725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).