About 2,2-diethylsiletane
2,2-diethylsiletane (PubChem CID 123533855) has the molecular formula C7H16Si
and a molecular weight of 128.29 g/mol. Its IUPAC name is 2,2-diethylsiletane.
Molecular Properties
| Compound Name | 2,2-diethylsiletane |
| PubChem CID | 123533855 |
| Molecular Formula | C7H16Si |
| Molecular Weight | 128.29 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | 2,2-diethylsiletane |
| SMILES | CCC1(CC)CC[SiH2]1 |
| InChI | InChI=1S/C7H16Si/c1-3-7(4-2)5-6-8-7/h3-6,8H2,1-2H3 |
| InChIKey | MWDDKNCJARSKTO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethylsiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethylsiletane?
The IUPAC name of 2,2-diethylsiletane (CID 123533855) is 2,2-diethylsiletane.
What is the SMILES notation for 2,2-diethylsiletane?
The canonical SMILES for 2,2-diethylsiletane is CCC1(CC)CC[SiH2]1.
What is the InChIKey of 2,2-diethylsiletane?
The InChIKey is MWDDKNCJARSKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16Si/c1-3-7(4-2)5-6-8-7/h3-6,8H2,1-2H3.
What are the key properties of 2,2-diethylsiletane?
2,2-diethylsiletane has a molecular weight of 128.29 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethylsiletane is sourced from PubChem (CID 123533855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).