About 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 157208820) has the molecular formula C17H38O2
and a molecular weight of 274.49 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 157208820 |
| Molecular Formula | C17H38O2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.29 |
| IUPAC Name | 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(C)(C)COC(C)(C)C.CC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C9H20O.C8H18O/c1-8(2,3)7-10-9(4,5)6;1-7(2,3)9-8(4,5)6/h7H2,1-6H3;1-6H3 |
| InChIKey | ARQRSTGASOVQSX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 157208820) is 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is CC(C)(C)COC(C)(C)C.CC(C)(C)OC(C)(C)C.
What is the InChIKey of 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is ARQRSTGASOVQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O.C8H18O/c1-8(2,3)7-10-9(4,5)6;1-7(2,3)9-8(4,5)6/h7H2,1-6H3;1-6H3.
What are the key properties of 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 274.49 g/mol, XLogP of 5.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxy]propane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 157208820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).