About diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol
diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol (PubChem CID 157208856) has the molecular formula C9H25NO5P+
and a molecular weight of 258.27 g/mol. Its IUPAC name is diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 157208856 |
| Molecular Formula | C9H25NO5P+ |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCO[P+](C)(O)OCC.OCCNCCO |
| InChI | InChI=1S/C5H14O3P.C4H11NO2/c1-4-7-9(3,6)8-5-2;6-3-1-5-2-4-7/h6H,4-5H2,1-3H3;5-7H,1-4H2/q+1; |
| InChIKey | WQOAHZLZALRNCV-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol?
The IUPAC name of diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol (CID 157208856) is diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol is CCO[P+](C)(O)OCC.OCCNCCO.
What is the InChIKey of diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol?
The InChIKey is WQOAHZLZALRNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O3P.C4H11NO2/c1-4-7-9(3,6)8-5-2;6-3-1-5-2-4-7/h6H,4-5H2,1-3H3;5-7H,1-4H2/q+1;.
What are the key properties of diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol?
diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol has a molecular weight of 258.27 g/mol, XLogP of 0.00, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-hydroxy-methylphosphanium;2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 157208856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).