About 1-(ethylamino)ethanol;2-(ethylamino)ethanol
1-(ethylamino)ethanol;2-(ethylamino)ethanol (PubChem CID 157298760) has the molecular formula C8H22N2O2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(ethylamino)ethanol;2-(ethylamino)ethanol.
Molecular Properties
| Compound Name | 1-(ethylamino)ethanol;2-(ethylamino)ethanol |
| PubChem CID | 157298760 |
| Molecular Formula | C8H22N2O2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-(ethylamino)ethanol;2-(ethylamino)ethanol |
| SMILES | CCNC(C)O.CCNCCO |
| InChI | InChI=1S/2C4H11NO/c1-3-5-4(2)6;1-2-5-3-4-6/h4-6H,3H2,1-2H3;5-6H,2-4H2,1H3 |
| InChIKey | BBQMSJCYWLBZRN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylamino)ethanol;2-(ethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)ethanol;2-(ethylamino)ethanol?
The IUPAC name of 1-(ethylamino)ethanol;2-(ethylamino)ethanol (CID 157298760) is 1-(ethylamino)ethanol;2-(ethylamino)ethanol.
What is the SMILES notation for 1-(ethylamino)ethanol;2-(ethylamino)ethanol?
The canonical SMILES for 1-(ethylamino)ethanol;2-(ethylamino)ethanol is CCNC(C)O.CCNCCO.
What is the InChIKey of 1-(ethylamino)ethanol;2-(ethylamino)ethanol?
The InChIKey is BBQMSJCYWLBZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11NO/c1-3-5-4(2)6;1-2-5-3-4-6/h4-6H,3H2,1-2H3;5-6H,2-4H2,1H3.
What are the key properties of 1-(ethylamino)ethanol;2-(ethylamino)ethanol?
1-(ethylamino)ethanol;2-(ethylamino)ethanol has a molecular weight of 178.28 g/mol, XLogP of -0.48, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)ethanol;2-(ethylamino)ethanol is sourced from PubChem (CID 157298760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).