About 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol
2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol (PubChem CID 88755673) has the molecular formula C10H29N3O3
and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol.
Molecular Properties
| Compound Name | 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol |
| PubChem CID | 88755673 |
| Molecular Formula | C10H29N3O3 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol |
| SMILES | CCNC(C)O.CN(C)CCO.NCCO |
| InChI | InChI=1S/2C4H11NO.C2H7NO/c1-5(2)3-4-6;1-3-5-4(2)6;3-1-2-4/h6H,3-4H2,1-2H3;4-6H,3H2,1-2H3;4H,1-3H2 |
| InChIKey | OIIWBDPTCWXRQO-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol?
The IUPAC name of 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol (CID 88755673) is 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol.
What is the SMILES notation for 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol?
The canonical SMILES for 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol is CCNC(C)O.CN(C)CCO.NCCO.
What is the InChIKey of 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol?
The InChIKey is OIIWBDPTCWXRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11NO.C2H7NO/c1-5(2)3-4-6;1-3-5-4(2)6;3-1-2-4/h6H,3-4H2,1-2H3;4-6H,3H2,1-2H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol?
2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol has a molecular weight of 239.36 g/mol, XLogP of -1.59, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-(dimethylamino)ethanol;1-(ethylamino)ethanol is sourced from PubChem (CID 88755673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).