About 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol
1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol (PubChem CID 175145973) has the molecular formula C9H24N2O3
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol.
Molecular Properties
| Compound Name | 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol |
| PubChem CID | 175145973 |
| Molecular Formula | C9H24N2O3 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol |
| SMILES | CCNC(C)O.CN(CCO)CCO |
| InChI | InChI=1S/C5H13NO2.C4H11NO/c1-6(2-4-7)3-5-8;1-3-5-4(2)6/h7-8H,2-5H2,1H3;4-6H,3H2,1-2H3 |
| InChIKey | NEPYBOALLBGXGI-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol?
The IUPAC name of 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol (CID 175145973) is 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol.
What is the SMILES notation for 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol?
The canonical SMILES for 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol is CCNC(C)O.CN(CCO)CCO.
What is the InChIKey of 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol?
The InChIKey is NEPYBOALLBGXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C4H11NO/c1-6(2-4-7)3-5-8;1-3-5-4(2)6/h7-8H,2-5H2,1H3;4-6H,3H2,1-2H3.
What are the key properties of 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol?
1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol has a molecular weight of 208.30 g/mol, XLogP of -1.16, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)ethanol;2-[2-hydroxyethyl(methyl)amino]ethanol is sourced from PubChem (CID 175145973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).