About cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane
cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane (PubChem CID 173039620) has the molecular formula C13H33NO5Si
and a molecular weight of 311.49 g/mol. Its IUPAC name is cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane.
Molecular Properties
| Compound Name | cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane |
| PubChem CID | 173039620 |
| Molecular Formula | C13H33NO5Si |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane |
| SMILES | C1CC1.CCO[SiH](OCC)OCC.OCCNCCO |
| InChI | InChI=1S/C6H16O3Si.C4H11NO2.C3H6/c1-4-7-10(8-5-2)9-6-3;6-3-1-5-2-4-7;1-2-3-1/h10H,4-6H2,1-3H3;5-7H,1-4H2;1-3H2 |
| InChIKey | GTARQGZNONIXDT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane?
The IUPAC name of cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane (CID 173039620) is cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane.
What is the SMILES notation for cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane?
The canonical SMILES for cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane is C1CC1.CCO[SiH](OCC)OCC.OCCNCCO.
What is the InChIKey of cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane?
The InChIKey is GTARQGZNONIXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C4H11NO2.C3H6/c1-4-7-10(8-5-2)9-6-3;6-3-1-5-2-4-7;1-2-3-1/h10H,4-6H2,1-3H3;5-7H,1-4H2;1-3H2.
What are the key properties of cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane?
cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane has a molecular weight of 311.49 g/mol, XLogP of 0.54, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;2-(2-hydroxyethylamino)ethanol;triethoxysilane is sourced from PubChem (CID 173039620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).