C18H40N8O2 — CID 157209185
N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 157209185) has the molecular formula C18H40N8O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 157209185 |
| Molecular Formula | C18H40N8O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)NCCN)CC1.CN1CCN(CC(=O)NCCN)CC1 |
| InChI | InChI=1S/2C9H20N4O/c2*1-12-4-6-13(7-5-12)8-9(14)11-3-2-10/h2*2-8,10H2,1H3,(H,11,14) |
| InChIKey | ARRSTWVYBJELOM-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |