C26H31F3N2O3 — CID 157209727
(2S)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]-2-[2-(trifluoromethyl)phenyl]acetic acid (PubChem CID 157209727) has the molecular formula C26H31F3N2O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is (2S)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]-2-[2-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | (2S)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]-2-[2-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 157209727 |
| Molecular Formula | C26H31F3N2O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (2S)-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]-2-[2-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)[C@H](c1ccccc1C(F)(F)F)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C26H31F3N2O3/c27-26(28,29)22-10-3-2-9-21(22)24(25(32)33)31-15-14-20(17-31)34-16-6-5-8-19-13-12-18-7-1-4-11-23(18)30-19/h2-3,9-10,12-13,20,24H,1,4-8,11,14-17H2,(H,32,33)/t20-,24+/m1/s1 |
| InChIKey | PLDFHHOTLOFADB-YKSBVNFPSA-N |
| XLogP | 5.22 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|