C11H14 — CID 15721127
(5E)-2,6-dimethylnona-2,3,5-trien-7-yne (PubChem CID 15721127) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (5E)-2,6-dimethylnona-2,3,5-trien-7-yne.
| Compound Name | (5E)-2,6-dimethylnona-2,3,5-trien-7-yne |
|---|---|
| PubChem CID | 15721127 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (5E)-2,6-dimethylnona-2,3,5-trien-7-yne |
| SMILES | CC#C/C(C)=C/C=C=C(C)C |
| InChI | InChI=1S/C11H14/c1-5-7-11(4)9-6-8-10(2)3/h6,9H,1-4H3/b11-9+ |
| InChIKey | YLNSQBFAAGIIKB-PKNBQFBNSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|