C8H9F — CID 130347412
(3E,5E)-6-fluoro-3-methylhepta-3,5-dien-1-yne (PubChem CID 130347412) has the molecular formula C8H9F and a molecular weight of 124.16 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-3-methylhepta-3,5-dien-1-yne.
| Compound Name | (3E,5E)-6-fluoro-3-methylhepta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 130347412 |
| Molecular Formula | C8H9F |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | (3E,5E)-6-fluoro-3-methylhepta-3,5-dien-1-yne |
| SMILES | C#C/C(C)=C/C=C(\C)F |
| InChI | InChI=1S/C8H9F/c1-4-7(2)5-6-8(3)9/h1,5-6H,2-3H3/b7-5+,8-6+ |
| InChIKey | DDAYGHYAYTUQFM-KQQUZDAGSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|