C13H15F — CID 171074942
(2E,4E,8E)-5-ethenyl-3-fluoro-8-methyldeca-2,4,8-trien-6-yne (PubChem CID 171074942) has the molecular formula C13H15F and a molecular weight of 190.26 g/mol. Its IUPAC name is (2E,4E,8E)-5-ethenyl-3-fluoro-8-methyldeca-2,4,8-trien-6-yne.
| Compound Name | (2E,4E,8E)-5-ethenyl-3-fluoro-8-methyldeca-2,4,8-trien-6-yne |
|---|---|
| PubChem CID | 171074942 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2E,4E,8E)-5-ethenyl-3-fluoro-8-methyldeca-2,4,8-trien-6-yne |
| SMILES | C=C/C(C#C/C(C)=C/C)=C\C(F)=C/C |
| InChI | InChI=1S/C13H15F/c1-5-11(4)8-9-12(6-2)10-13(14)7-3/h5-7,10H,2H2,1,3-4H3/b11-5+,12-10+,13-7+ |
| InChIKey | GZDIMCFOLTZOMP-WUJCYSCDSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|