C9H11F — CID 143767081
(3E,5E)-6-fluoro-3-methylocta-3,5-dien-1-yne (PubChem CID 143767081) has the molecular formula C9H11F and a molecular weight of 138.18 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-3-methylocta-3,5-dien-1-yne.
| Compound Name | (3E,5E)-6-fluoro-3-methylocta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 143767081 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.18 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3E,5E)-6-fluoro-3-methylocta-3,5-dien-1-yne |
| SMILES | C#C/C(C)=C/C=C(/F)CC |
| InChI | InChI=1S/C9H11F/c1-4-8(3)6-7-9(10)5-2/h1,6-7H,5H2,2-3H3/b8-6+,9-7+ |
| InChIKey | LVIRIDCGKQUPJB-CDJQDVQCSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|