About (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne
(3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne (PubChem CID 134566725) has the molecular formula C9H9F3
and a molecular weight of 174.16 g/mol. Its IUPAC name is (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne.
Molecular Properties
| Compound Name | (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne |
| PubChem CID | 134566725 |
| Molecular Formula | C9H9F3 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne |
| SMILES | C#C/C(=C\C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H9F3/c1-4-8(9(10,11)12)6-5-7(2)3/h1,5-6H,2-3H3/b8-6+ |
| InChIKey | OXLJZUAESUDSDX-SOFGYWHQSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne?
The IUPAC name of (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne (CID 134566725) is (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne.
What is the SMILES notation for (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne?
The canonical SMILES for (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne is C#C/C(=C\C=C(C)C)C(F)(F)F.
What is the InChIKey of (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne?
The InChIKey is OXLJZUAESUDSDX-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H9F3/c1-4-8(9(10,11)12)6-5-7(2)3/h1,5-6H,2-3H3/b8-6+.
What are the key properties of (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne?
(3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne has a molecular weight of 174.16 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-methyl-3-(trifluoromethyl)hepta-3,5-dien-1-yne is sourced from PubChem (CID 134566725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).