C10H12 — CID 134993465
(3Z)-3,7-dimethylocta-3,5,6-trien-1-yne (PubChem CID 134993465) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is (3Z)-3,7-dimethylocta-3,5,6-trien-1-yne.
| Compound Name | (3Z)-3,7-dimethylocta-3,5,6-trien-1-yne |
|---|---|
| PubChem CID | 134993465 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (3Z)-3,7-dimethylocta-3,5,6-trien-1-yne |
| SMILES | C#C/C(C)=C\C=C=C(C)C |
| InChI | InChI=1S/C10H12/c1-5-10(4)8-6-7-9(2)3/h1,6,8H,2-4H3/b10-8- |
| InChIKey | BHFLUEPCFUECCM-NTMALXAHSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|