C42H46F2N8O6 — CID 157211707
N-[7-[(2S,3R,4R,5R)-5-ethyl-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide (PubChem CID 157211707) has the molecular formula C42H46F2N8O6 and a molecular weight of 796.88 g/mol. Its IUPAC name is N-[7-[(2S,3R,4R,5R)-5-ethyl-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide.
| Compound Name | N-[7-[(2S,3R,4R,5R)-5-ethyl-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide |
|---|---|
| PubChem CID | 157211707 |
| Molecular Formula | C42H46F2N8O6 |
| Molecular Weight | 796.88 g/mol |
| Exact Mass | 796.35 |
| IUPAC Name | N-[7-[(2S,3R,4R,5R)-5-ethyl-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide |
| SMILES | CC[C@@]1(CO)O[C@@H](c2ccc3c(NC(=O)c4ccccc4)ncnn23)[C@H](F)[C@@H]1C.CC[C@@]1(CO)O[C@@H](c2ccc3c(NC(=O)c4ccccc4)ncnn23)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/2C21H23FN4O3/c2*1-3-21(11-27)13(2)17(22)18(29-21)15-9-10-16-19(23-12-24-26(15)16)25-20(28)14-7-5-4-6-8-14/h2*4-10,12-13,17-18,27H,3,11H2,1-2H3,(H,23,24,25,28)/t2*13-,17+,18-,21-/m00/s1 |
| InChIKey | ARYQGSNPAWZDIF-YIGFTVACSA-N |
| XLogP | 6.34 |
| TPSA | 177.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.88 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |