About 2-tert-butyl-4-methoxyphenolate;diethylalumanylium
2-tert-butyl-4-methoxyphenolate;diethylalumanylium (PubChem CID 157212968) has the molecular formula C15H25AlO2
and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-tert-butyl-4-methoxyphenolate;diethylalumanylium.
Molecular Properties
| Compound Name | 2-tert-butyl-4-methoxyphenolate;diethylalumanylium |
| PubChem CID | 157212968 |
| Molecular Formula | C15H25AlO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-tert-butyl-4-methoxyphenolate;diethylalumanylium |
| SMILES | CC[Al+]CC.COc1ccc([O-])c(C(C)(C)C)c1 |
| InChI | InChI=1S/C11H16O2.2C2H5.Al/c1-11(2,3)9-7-8(13-4)5-6-10(9)12;2*1-2;/h5-7,12H,1-4H3;2*1H2,2H3;/q;;;+1/p-1 |
| InChIKey | XLQXHNGOIYYTPH-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-4-methoxyphenolate;diethylalumanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-methoxyphenolate;diethylalumanylium?
The IUPAC name of 2-tert-butyl-4-methoxyphenolate;diethylalumanylium (CID 157212968) is 2-tert-butyl-4-methoxyphenolate;diethylalumanylium.
What is the SMILES notation for 2-tert-butyl-4-methoxyphenolate;diethylalumanylium?
The canonical SMILES for 2-tert-butyl-4-methoxyphenolate;diethylalumanylium is CC[Al+]CC.COc1ccc([O-])c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-4-methoxyphenolate;diethylalumanylium?
The InChIKey is XLQXHNGOIYYTPH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16O2.2C2H5.Al/c1-11(2,3)9-7-8(13-4)5-6-10(9)12;2*1-2;/h5-7,12H,1-4H3;2*1H2,2H3;/q;;;+1/p-1.
What are the key properties of 2-tert-butyl-4-methoxyphenolate;diethylalumanylium?
2-tert-butyl-4-methoxyphenolate;diethylalumanylium has a molecular weight of 264.34 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-methoxyphenolate;diethylalumanylium is sourced from PubChem (CID 157212968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).