C9H14N4 — CID 15721514
N,N'-diamino-N,4-dimethylbenzenecarboximidamide (PubChem CID 15721514) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is N,N'-diamino-N,4-dimethylbenzenecarboximidamide.
| Compound Name | N,N'-diamino-N,4-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 15721514 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N,N'-diamino-N,4-dimethylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(=N/N)N(C)N)cc1 |
| InChI | InChI=1S/C9H14N4/c1-7-3-5-8(6-4-7)9(12-10)13(2)11/h3-6H,10-11H2,1-2H3/b12-9- |
| InChIKey | WFPYIPAZRSOTMM-XFXZXTDPSA-N |
| XLogP | 0.42 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|