C8H12N4 — CID 15721498
N,N'-diamino-4-methylbenzenecarboximidamide (PubChem CID 15721498) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is N,N'-diamino-4-methylbenzenecarboximidamide.
| Compound Name | N,N'-diamino-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 15721498 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N,N'-diamino-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C8H12N4/c1-6-2-4-7(5-3-6)8(11-9)12-10/h2-5H,9-10H2,1H3,(H,11,12) |
| InChIKey | YSIUSSAISWANJU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|