C8H7Cl3N2 — CID 11630059
N,N,N'-trichloro-4-methylbenzenecarboximidamide (PubChem CID 11630059) has the molecular formula C8H7Cl3N2 and a molecular weight of 237.52 g/mol. Its IUPAC name is N,N,N'-trichloro-4-methylbenzenecarboximidamide.
| Compound Name | N,N,N'-trichloro-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 11630059 |
| Molecular Formula | C8H7Cl3N2 |
| Molecular Weight | 237.52 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | N,N,N'-trichloro-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(=N\Cl)N(Cl)Cl)cc1 |
| InChI | InChI=1S/C8H7Cl3N2/c1-6-2-4-7(5-3-6)8(12-9)13(10)11/h2-5H,1H3/b12-8+ |
| InChIKey | KXENFCQINFLXLV-XYOKQWHBSA-N |
| XLogP | 3.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|