C17H26Cl2OS — CID 157216312
1,3-dichlorobenzene;2-ethylnonanethioic S-acid (PubChem CID 157216312) has the molecular formula C17H26Cl2OS and a molecular weight of 349.37 g/mol. Its IUPAC name is 1,3-dichlorobenzene;2-ethylnonanethioic S-acid.
| Compound Name | 1,3-dichlorobenzene;2-ethylnonanethioic S-acid |
|---|---|
| PubChem CID | 157216312 |
| Molecular Formula | C17H26Cl2OS |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1,3-dichlorobenzene;2-ethylnonanethioic S-acid |
| SMILES | CCCCCCCC(CC)C(=O)S.Clc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H22OS.C6H4Cl2/c1-3-5-6-7-8-9-10(4-2)11(12)13;7-5-2-1-3-6(8)4-5/h10H,3-9H2,1-2H3,(H,12,13);1-4H |
| InChIKey | ASLNZKGRQHJMKI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|