C26H28N4O4 — CID 157220767
2-[[4-(6-aminohexanoyl)benzoyl]amino]-5-methoxy-N-pyridin-2-ylbenzamide (PubChem CID 157220767) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[[4-(6-aminohexanoyl)benzoyl]amino]-5-methoxy-N-pyridin-2-ylbenzamide.
| Compound Name | 2-[[4-(6-aminohexanoyl)benzoyl]amino]-5-methoxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 157220767 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[[4-(6-aminohexanoyl)benzoyl]amino]-5-methoxy-N-pyridin-2-ylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C(=O)CCCCCN)cc2)c(C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C26H28N4O4/c1-34-20-13-14-22(21(17-20)26(33)30-24-8-4-6-16-28-24)29-25(32)19-11-9-18(10-12-19)23(31)7-3-2-5-15-27/h4,6,8-14,16-17H,2-3,5,7,15,27H2,1H3,(H,29,32)(H,28,30,33) |
| InChIKey | FXHSYWFOQJTLLM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|