C22H28N8O3 — CID 157222749
3-[8-(3-aminopiperidin-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]benzonitrile;N,N-dimethylformamide (PubChem CID 157222749) has the molecular formula C22H28N8O3 and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-[8-(3-aminopiperidin-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]benzonitrile;N,N-dimethylformamide.
| Compound Name | 3-[8-(3-aminopiperidin-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]benzonitrile;N,N-dimethylformamide |
|---|---|
| PubChem CID | 157222749 |
| Molecular Formula | C22H28N8O3 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-[8-(3-aminopiperidin-1-yl)-1,3-dimethyl-2,6-dioxopurin-7-yl]benzonitrile;N,N-dimethylformamide |
| SMILES | CN(C)C=O.Cn1c(=O)c2c(nc(N3CCCC(N)C3)n2-c2cccc(C#N)c2)n(C)c1=O |
| InChI | InChI=1S/C19H21N7O2.C3H7NO/c1-23-16-15(17(27)24(2)19(23)28)26(14-7-3-5-12(9-14)10-20)18(22-16)25-8-4-6-13(21)11-25;1-4(2)3-5/h3,5,7,9,13H,4,6,8,11,21H2,1-2H3;3H,1-2H3 |
| InChIKey | ATEKUKBPNOSTMW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|