C12H16FN2O4PS3 — CID 157222927
1-[(2R,3R,4R,5S)-3-fluoro-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 157222927) has the molecular formula C12H16FN2O4PS3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-3-fluoro-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5S)-3-fluoro-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157222927 |
| Molecular Formula | C12H16FN2O4PS3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-3-fluoro-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@H]1[C@@H](F)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COP1(=S)SCCS1 |
| InChI | InChI=1S/C12H16FN2O4PS3/c1-7-8(6-18-20(21)22-4-5-23-20)19-11(10(7)13)15-3-2-9(16)14-12(15)17/h2-3,7-8,10-11H,4-6H2,1H3,(H,14,16,17)/t7-,8-,10-,11-/m1/s1 |
| InChIKey | ATEZKCFQNLFEFL-YJFSRANCSA-N |
| XLogP | 2.13 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|