C11H17N2O5P — CID 123532050
[5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethyloxolan-2-yl]methoxyphosphinous acid (PubChem CID 123532050) has the molecular formula C11H17N2O5P and a molecular weight of 288.24 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethyloxolan-2-yl]methoxyphosphinous acid.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethyloxolan-2-yl]methoxyphosphinous acid |
|---|---|
| PubChem CID | 123532050 |
| Molecular Formula | C11H17N2O5P |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethyloxolan-2-yl]methoxyphosphinous acid |
| SMILES | CC1C(COPO)OC(n2ccc(=O)[nH]c2=O)C1C |
| InChI | InChI=1S/C11H17N2O5P/c1-6-7(2)10(18-8(6)5-17-19-16)13-4-3-9(14)12-11(13)15/h3-4,6-8,10,16,19H,5H2,1-2H3,(H,12,14,15) |
| InChIKey | HETABFWCHMCAMV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|