C11H15ClN2O3 — CID 59891166
1-[(2S,5S)-3-chloro-5-ethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59891166) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.71 g/mol. Its IUPAC name is 1-[(2S,5S)-3-chloro-5-ethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-3-chloro-5-ethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59891166 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[(2S,5S)-3-chloro-5-ethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@@H]1O[C@H](n2ccc(=O)[nH]c2=O)C(Cl)C1C |
| InChI | InChI=1S/C11H15ClN2O3/c1-3-7-6(2)9(12)10(17-7)14-5-4-8(15)13-11(14)16/h4-7,9-10H,3H2,1-2H3,(H,13,15,16)/t6?,7-,9?,10-/m0/s1 |
| InChIKey | LGPMIMXADYWFGR-QBKPHXBPSA-N |
| XLogP | 1.09 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|