C25H28BF2NO6S — CID 157225688
N-[2-(2,4-difluorophenyl)-3-propanoyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-yl]-N-methylmethanesulfonamide (PubChem CID 157225688) has the molecular formula C25H28BF2NO6S and a molecular weight of 519.38 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-3-propanoyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-3-propanoyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 157225688 |
| Molecular Formula | C25H28BF2NO6S |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-3-propanoyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-yl]-N-methylmethanesulfonamide |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2F)oc2cc(N(C)S(C)(=O)=O)c(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C25H28BF2NO6S/c1-8-20(30)22-16-12-17(26-34-24(2,3)25(4,5)35-26)19(29(6)36(7,31)32)13-21(16)33-23(22)15-10-9-14(27)11-18(15)28/h9-13H,8H2,1-7H3 |
| InChIKey | BVZNRTKXFQRFRZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|