C13H9F6N3O2 — CID 157229801
2-amino-3-methyl-4-(trifluoromethyl)-5-[4-(trifluoromethyl)imidazol-1-yl]benzoic acid (PubChem CID 157229801) has the molecular formula C13H9F6N3O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 2-amino-3-methyl-4-(trifluoromethyl)-5-[4-(trifluoromethyl)imidazol-1-yl]benzoic acid.
| Compound Name | 2-amino-3-methyl-4-(trifluoromethyl)-5-[4-(trifluoromethyl)imidazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 157229801 |
| Molecular Formula | C13H9F6N3O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-amino-3-methyl-4-(trifluoromethyl)-5-[4-(trifluoromethyl)imidazol-1-yl]benzoic acid |
| SMILES | Cc1c(N)c(C(=O)O)cc(-n2cnc(C(F)(F)F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C13H9F6N3O2/c1-5-9(13(17,18)19)7(2-6(10(5)20)11(23)24)22-3-8(21-4-22)12(14,15)16/h2-4H,20H2,1H3,(H,23,24) |
| InChIKey | ATYVBQNAWBFKED-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|