C28H26F2N2O5 — CID 157230177
(2'R,4S)-7-[3-(2,4-difluorophenyl)propanoyl]-2'-(hydroxymethyl)-2-methyl-9-phenylmethoxyspiro[3H-pyrido[1,2-a]pyrazine-4,1'-cyclopropane]-1,8-dione (PubChem CID 157230177) has the molecular formula C28H26F2N2O5 and a molecular weight of 508.52 g/mol. Its IUPAC name is (2'R,4S)-7-[3-(2,4-difluorophenyl)propanoyl]-2'-(hydroxymethyl)-2-methyl-9-phenylmethoxyspiro[3H-pyrido[1,2-a]pyrazine-4,1'-cyclopropane]-1,8-dione.
| Compound Name | (2'R,4S)-7-[3-(2,4-difluorophenyl)propanoyl]-2'-(hydroxymethyl)-2-methyl-9-phenylmethoxyspiro[3H-pyrido[1,2-a]pyrazine-4,1'-cyclopropane]-1,8-dione |
|---|---|
| PubChem CID | 157230177 |
| Molecular Formula | C28H26F2N2O5 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (2'R,4S)-7-[3-(2,4-difluorophenyl)propanoyl]-2'-(hydroxymethyl)-2-methyl-9-phenylmethoxyspiro[3H-pyrido[1,2-a]pyrazine-4,1'-cyclopropane]-1,8-dione |
| SMILES | CN1C[C@@]2(C[C@H]2CO)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(OCc3ccccc3)c2C1=O |
| InChI | InChI=1S/C28H26F2N2O5/c1-31-16-28(12-19(28)14-33)32-13-21(23(34)10-8-18-7-9-20(29)11-22(18)30)25(35)26(24(32)27(31)36)37-15-17-5-3-2-4-6-17/h2-7,9,11,13,19,33H,8,10,12,14-16H2,1H3/t19-,28+/m0/s1 |
| InChIKey | WBUCVFBBIVJIRT-HMILPKGGSA-N |
| XLogP | 3.31 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |