C20H22N4O2 — CID 157230317
[2-amino-5-(4-methylpiperazin-1-yl)-4-(2-phenylethynyl)phenyl]carbamic acid (PubChem CID 157230317) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-amino-5-(4-methylpiperazin-1-yl)-4-(2-phenylethynyl)phenyl]carbamic acid.
| Compound Name | [2-amino-5-(4-methylpiperazin-1-yl)-4-(2-phenylethynyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 157230317 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [2-amino-5-(4-methylpiperazin-1-yl)-4-(2-phenylethynyl)phenyl]carbamic acid |
| SMILES | CN1CCN(c2cc(NC(=O)O)c(N)cc2C#Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N4O2/c1-23-9-11-24(12-10-23)19-14-18(22-20(25)26)17(21)13-16(19)8-7-15-5-3-2-4-6-15/h2-6,13-14,22H,9-12,21H2,1H3,(H,25,26) |
| InChIKey | AUAHKSRSXPRAKS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|