C22H24BN2+ — CID 157232380
2-(1,5-dimethylquinolin-1-ium-2-yl)-1,3-dimethyl-4-(trideuteriomethyl)-1,2-benzazaborinine (PubChem CID 157232380) has the molecular formula C22H24BN2+ and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-(1,5-dimethylquinolin-1-ium-2-yl)-1,3-dimethyl-4-(trideuteriomethyl)-1,2-benzazaborinine.
| Compound Name | 2-(1,5-dimethylquinolin-1-ium-2-yl)-1,3-dimethyl-4-(trideuteriomethyl)-1,2-benzazaborinine |
|---|---|
| PubChem CID | 157232380 |
| Molecular Formula | C22H24BN2+ |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-(1,5-dimethylquinolin-1-ium-2-yl)-1,3-dimethyl-4-(trideuteriomethyl)-1,2-benzazaborinine |
| SMILES | [2H]C([2H])([2H])C1=C(C)B(c2ccc3c(C)cccc3[n+]2C)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H24BN2/c1-15-9-8-12-20-18(15)13-14-22(24(20)4)23-17(3)16(2)19-10-6-7-11-21(19)25(23)5/h6-14H,1-5H3/q+1/i2D3 |
| InChIKey | MALHEGWBTIBPDV-BMSJAHLVSA-N |
| XLogP | 3.65 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|