C21H22BN2+ — CID 161191977
1-(1,5-dimethylquinolin-1-ium-2-yl)-2-methyl-3-(trideuteriomethyl)-1,2-benzazaborinine (PubChem CID 161191977) has the molecular formula C21H22BN2+ and a molecular weight of 316.25 g/mol. Its IUPAC name is 1-(1,5-dimethylquinolin-1-ium-2-yl)-2-methyl-3-(trideuteriomethyl)-1,2-benzazaborinine.
| Compound Name | 1-(1,5-dimethylquinolin-1-ium-2-yl)-2-methyl-3-(trideuteriomethyl)-1,2-benzazaborinine |
|---|---|
| PubChem CID | 161191977 |
| Molecular Formula | C21H22BN2+ |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 1-(1,5-dimethylquinolin-1-ium-2-yl)-2-methyl-3-(trideuteriomethyl)-1,2-benzazaborinine |
| SMILES | [2H]C([2H])([2H])C1=Cc2ccccc2N(c2ccc3c(C)cccc3[n+]2C)B1C |
| InChI | InChI=1S/C21H22BN2/c1-15-8-7-11-20-18(15)12-13-21(23(20)4)24-19-10-6-5-9-17(19)14-16(2)22(24)3/h5-14H,1-4H3/q+1/i2D3 |
| InChIKey | VMWDQMUMFPDLGG-BMSJAHLVSA-N |
| XLogP | 4.69 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|