C22H24N3+ — CID 140944487
(2R)-2-methyl-1-(2-methylphenyl)-3-[1-methyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-2H-benzimidazole (PubChem CID 140944487) has the molecular formula C22H24N3+ and a molecular weight of 333.47 g/mol. Its IUPAC name is (2R)-2-methyl-1-(2-methylphenyl)-3-[1-methyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-2H-benzimidazole.
| Compound Name | (2R)-2-methyl-1-(2-methylphenyl)-3-[1-methyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-2H-benzimidazole |
|---|---|
| PubChem CID | 140944487 |
| Molecular Formula | C22H24N3+ |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (2R)-2-methyl-1-(2-methylphenyl)-3-[1-methyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-2H-benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc[n+](C)c(N2c3ccccc3N(c3ccccc3C)[C@H]2C)c1 |
| InChI | InChI=1S/C22H24N3/c1-16-13-14-23(4)22(15-16)25-18(3)24(19-10-6-5-9-17(19)2)20-11-7-8-12-21(20)25/h5-15,18H,1-4H3/q+1/t18-/m1/s1/i1D3 |
| InChIKey | CMHMSFLRTXQCAR-HLENTGRASA-N |
| XLogP | 4.76 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|