C11H18N+ — CID 176815536
2-tert-butyl-1-methyl-4-(trideuteriomethyl)pyridin-1-ium (PubChem CID 176815536) has the molecular formula C11H18N+ and a molecular weight of 167.29 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-4-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-tert-butyl-1-methyl-4-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 176815536 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 167.29 g/mol |
| Exact Mass | 167.16 |
| IUPAC Name | 2-tert-butyl-1-methyl-4-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc[n+](C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C11H18N/c1-9-6-7-12(5)10(8-9)11(2,3)4/h6-8H,1-5H3/q+1/i1D3 |
| InChIKey | WNQAEMLOGDDMLE-FIBGUPNXSA-N |
| XLogP | 2.12 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|