C12H20N+ — CID 176815543
2-tert-butyl-1-methyl-3,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 176815543) has the molecular formula C12H20N+ and a molecular weight of 184.34 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-3,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-tert-butyl-1-methyl-3,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 176815543 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 184.34 g/mol |
| Exact Mass | 184.20 |
| IUPAC Name | 2-tert-butyl-1-methyl-3,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C([2H])([2H])[2H])c(C(C)(C)C)[n+](C)c1 |
| InChI | InChI=1S/C12H20N/c1-9-7-10(2)11(12(3,4)5)13(6)8-9/h7-8H,1-6H3/q+1/i1D3,2D3 |
| InChIKey | JXHYSPXLCULFPU-WFGJKAKNSA-N |
| XLogP | 2.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|