C23H46N4O4 — CID 157233157
tert-butyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate;tert-butyl (3S,5R)-3,4,5-trimethylpiperazine-1-carboxylate (PubChem CID 157233157) has the molecular formula C23H46N4O4 and a molecular weight of 442.65 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate;tert-butyl (3S,5R)-3,4,5-trimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate;tert-butyl (3S,5R)-3,4,5-trimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 157233157 |
| Molecular Formula | C23H46N4O4 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.35 |
| IUPAC Name | tert-butyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate;tert-butyl (3S,5R)-3,4,5-trimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H](C)N1.C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H](C)N1C |
| InChI | InChI=1S/C12H24N2O2.C11H22N2O2/c1-9-7-14(8-10(2)13(9)6)11(15)16-12(3,4)5;1-8-6-13(7-9(2)12-8)10(14)15-11(3,4)5/h9-10H,7-8H2,1-6H3;8-9,12H,6-7H2,1-5H3/t9-,10+;8-,9+ |
| InChIKey | AUIHOVPOCCQQAE-ZVBVSELFSA-N |
| XLogP | 3.55 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |