C24H28Cl2N2O6 — CID 157244391
(2S)-2-[(2,5-dichlorobenzoyl)-[3-(2,4-dimethoxyphenyl)propanoylamino]amino]-4-methylpentanoic acid (PubChem CID 157244391) has the molecular formula C24H28Cl2N2O6 and a molecular weight of 511.40 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorobenzoyl)-[3-(2,4-dimethoxyphenyl)propanoylamino]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(2,5-dichlorobenzoyl)-[3-(2,4-dimethoxyphenyl)propanoylamino]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 157244391 |
| Molecular Formula | C24H28Cl2N2O6 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (2S)-2-[(2,5-dichlorobenzoyl)-[3-(2,4-dimethoxyphenyl)propanoylamino]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc(CCC(=O)NN(C(=O)c2cc(Cl)ccc2Cl)[C@@H](CC(C)C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C24H28Cl2N2O6/c1-14(2)11-20(24(31)32)28(23(30)18-12-16(25)7-9-19(18)26)27-22(29)10-6-15-5-8-17(33-3)13-21(15)34-4/h5,7-9,12-14,20H,6,10-11H2,1-4H3,(H,27,29)(H,31,32)/t20-/m0/s1 |
| InChIKey | YRFRHQPNYLWZAI-FQEVSTJZSA-N |
| XLogP | 4.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|