C44H38N8O7S — CID 157245813
N-(4-aminophenyl)-1,3-benzodioxole-4-carboxamide;[3-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-phenylthiadiazole-5-carboxamide (PubChem CID 157245813) has the molecular formula C44H38N8O7S and a molecular weight of 822.90 g/mol. Its IUPAC name is N-(4-aminophenyl)-1,3-benzodioxole-4-carboxamide;[3-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-phenylthiadiazole-5-carboxamide.
| Compound Name | N-(4-aminophenyl)-1,3-benzodioxole-4-carboxamide;[3-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-phenylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 157245813 |
| Molecular Formula | C44H38N8O7S |
| Molecular Weight | 822.90 g/mol |
| Exact Mass | 822.26 |
| IUPAC Name | N-(4-aminophenyl)-1,3-benzodioxole-4-carboxamide;[3-[(4-aminophenyl)carbamoyl]phenyl] acetate;N-(4-aminophenyl)-4-phenylthiadiazole-5-carboxamide |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(N)cc2)c1.Nc1ccc(NC(=O)c2cccc3c2OCO3)cc1.Nc1ccc(NC(=O)c2snnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N4OS.C15H14N2O3.C14H12N2O3/c16-11-6-8-12(9-7-11)17-15(20)14-13(18-19-21-14)10-4-2-1-3-5-10;1-10(18)20-14-4-2-3-11(9-14)15(19)17-13-7-5-12(16)6-8-13;15-9-4-6-10(7-5-9)16-14(17)11-2-1-3-12-13(11)19-8-18-12/h1-9H,16H2,(H,17,20);2-9H,16H2,1H3,(H,17,19);1-7H,8,15H2,(H,16,17) |
| InChIKey | AVTCQFPHWQMANH-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 235.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.90 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|