C29H28N4O7 — CID 70187586
[3-[(4-aminophenyl)carbamoyl]phenyl] acetate;benzene-1,4-diamine;1,3-benzodioxole-4-carboxylic acid (PubChem CID 70187586) has the molecular formula C29H28N4O7 and a molecular weight of 544.56 g/mol. Its IUPAC name is [3-[(4-aminophenyl)carbamoyl]phenyl] acetate;benzene-1,4-diamine;1,3-benzodioxole-4-carboxylic acid.
| Compound Name | [3-[(4-aminophenyl)carbamoyl]phenyl] acetate;benzene-1,4-diamine;1,3-benzodioxole-4-carboxylic acid |
|---|---|
| PubChem CID | 70187586 |
| Molecular Formula | C29H28N4O7 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [3-[(4-aminophenyl)carbamoyl]phenyl] acetate;benzene-1,4-diamine;1,3-benzodioxole-4-carboxylic acid |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(N)cc2)c1.Nc1ccc(N)cc1.O=C(O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C15H14N2O3.C8H6O4.C6H8N2/c1-10(18)20-14-4-2-3-11(9-14)15(19)17-13-7-5-12(16)6-8-13;9-8(10)5-2-1-3-6-7(5)12-4-11-6;7-5-1-2-6(8)4-3-5/h2-9H,16H2,1H3,(H,17,19);1-3H,4H2,(H,9,10);1-4H,7-8H2 |
| InChIKey | PJTSWVSCYMQPGT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 189.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|