C34H32ClN11O9 — CID 157246078
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(3-chloroquinolin-6-yl)methyl]-5-cyanotriazole-4-carboxamide;dimethyl but-2-ynedioate;dimethyl 2H-triazole-4,5-dicarboxylate (PubChem CID 157246078) has the molecular formula C34H32ClN11O9 and a molecular weight of 774.15 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(3-chloroquinolin-6-yl)methyl]-5-cyanotriazole-4-carboxamide;dimethyl but-2-ynedioate;dimethyl 2H-triazole-4,5-dicarboxylate.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(3-chloroquinolin-6-yl)methyl]-5-cyanotriazole-4-carboxamide;dimethyl but-2-ynedioate;dimethyl 2H-triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 157246078 |
| Molecular Formula | C34H32ClN11O9 |
| Molecular Weight | 774.15 g/mol |
| Exact Mass | 773.21 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-2-[(3-chloroquinolin-6-yl)methyl]-5-cyanotriazole-4-carboxamide;dimethyl but-2-ynedioate;dimethyl 2H-triazole-4,5-dicarboxylate |
| SMILES | COC(=O)C#CC(=O)OC.COC(=O)c1n[nH]nc1C(=O)OC.Cc1cc(N)nc(C)c1CNC(=O)c1nn(Cc2ccc3ncc(Cl)cc3c2)nc1C#N |
| InChI | InChI=1S/C22H19ClN8O.C6H7N3O4.C6H6O4/c1-12-5-20(25)28-13(2)17(12)10-27-22(32)21-19(8-24)29-31(30-21)11-14-3-4-18-15(6-14)7-16(23)9-26-18;1-12-5(10)3-4(6(11)13-2)8-9-7-3;1-9-5(7)3-4-6(8)10-2/h3-7,9H,10-11H2,1-2H3,(H2,25,28)(H,27,32);1-2H3,(H,7,8,9);1-2H3 |
| InChIKey | AVTYUUIDATXVRL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 282.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|