C32H27Cl3N8O8 — CID 159497659
3-chloro-6-(chloromethyl)quinoline;dimethyl 2-[(3-chloroquinolin-6-yl)methyl]triazole-4,5-dicarboxylate;dimethyl 2H-triazole-4,5-dicarboxylate (PubChem CID 159497659) has the molecular formula C32H27Cl3N8O8 and a molecular weight of 757.97 g/mol. Its IUPAC name is 3-chloro-6-(chloromethyl)quinoline;dimethyl 2-[(3-chloroquinolin-6-yl)methyl]triazole-4,5-dicarboxylate;dimethyl 2H-triazole-4,5-dicarboxylate.
| Compound Name | 3-chloro-6-(chloromethyl)quinoline;dimethyl 2-[(3-chloroquinolin-6-yl)methyl]triazole-4,5-dicarboxylate;dimethyl 2H-triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 159497659 |
| Molecular Formula | C32H27Cl3N8O8 |
| Molecular Weight | 757.97 g/mol |
| Exact Mass | 756.10 |
| IUPAC Name | 3-chloro-6-(chloromethyl)quinoline;dimethyl 2-[(3-chloroquinolin-6-yl)methyl]triazole-4,5-dicarboxylate;dimethyl 2H-triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1n[nH]nc1C(=O)OC.COC(=O)c1nn(Cc2ccc3ncc(Cl)cc3c2)nc1C(=O)OC.ClCc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C16H13ClN4O4.C10H7Cl2N.C6H7N3O4/c1-24-15(22)13-14(16(23)25-2)20-21(19-13)8-9-3-4-12-10(5-9)6-11(17)7-18-12;11-5-7-1-2-10-8(3-7)4-9(12)6-13-10;1-12-5(10)3-4(6(11)13-2)8-9-7-3/h3-7H,8H2,1-2H3;1-4,6H,5H2;1-2H3,(H,7,8,9) |
| InChIKey | LYZJOCVZFWEGIH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 203.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|