About 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid
4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid (PubChem CID 157246519) has the molecular formula C16H13F2N3O5
and a molecular weight of 365.29 g/mol. Its IUPAC name is 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid.
Molecular Properties
| Compound Name | 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid |
| PubChem CID | 157246519 |
| Molecular Formula | C16H13F2N3O5 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(F)cc1[N+](=O)[O-].Nc1cc(F)cc2c1CNC2=O |
| InChI | InChI=1S/C8H7FN2O.C8H6FNO4/c9-4-1-5-6(7(10)2-4)3-11-8(5)12;1-4-6(8(11)12)2-5(9)3-7(4)10(13)14/h1-2H,3,10H2,(H,11,12);2-3H,1H3,(H,11,12) |
| InChIKey | AVVJHSMICODUOP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid?
The IUPAC name of 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid (CID 157246519) is 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid.
What is the SMILES notation for 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid?
The canonical SMILES for 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid is Cc1c(C(=O)O)cc(F)cc1[N+](=O)[O-].Nc1cc(F)cc2c1CNC2=O.
What is the InChIKey of 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid?
The InChIKey is AVVJHSMICODUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2O.C8H6FNO4/c9-4-1-5-6(7(10)2-4)3-11-8(5)12;1-4-6(8(11)12)2-5(9)3-7(4)10(13)14/h1-2H,3,10H2,(H,11,12);2-3H,1H3,(H,11,12).
What are the key properties of 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid?
4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid has a molecular weight of 365.29 g/mol, XLogP of 2.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-fluoro-2,3-dihydroisoindol-1-one;5-fluoro-2-methyl-3-nitrobenzoic acid is sourced from PubChem (CID 157246519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).