C35H35BF2N4O6S2 — CID 157246606
5-fluoro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 157246606) has the molecular formula C35H35BF2N4O6S2 and a molecular weight of 720.63 g/mol. Its IUPAC name is 5-fluoro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 5-fluoro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 157246606 |
| Molecular Formula | C35H35BF2N4O6S2 |
| Molecular Weight | 720.63 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | 5-fluoro-3-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(B3OC(C)(C)C(C)(C)O3)c3cc(F)cnc32)cc1.Cc1ccc(S(=O)(=O)n2cc(C)c3cc(F)cnc32)cc1 |
| InChI | InChI=1S/C20H22BFN2O4S.C15H13FN2O2S/c1-13-6-8-15(9-7-13)29(25,26)24-12-17(16-10-14(22)11-23-18(16)24)21-27-19(2,3)20(4,5)28-21;1-10-3-5-13(6-4-10)21(19,20)18-9-11(2)14-7-12(16)8-17-15(14)18/h6-12H,1-5H3;3-9H,1-2H3 |
| InChIKey | AVVQBTRNSXBHIR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|