C40H39F3O5S — CID 157247028
2,3-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene;trifluoromethanesulfonic acid (PubChem CID 157247028) has the molecular formula C40H39F3O5S and a molecular weight of 688.81 g/mol. Its IUPAC name is 2,3-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene;trifluoromethanesulfonic acid.
| Compound Name | 2,3-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 157247028 |
| Molecular Formula | C40H39F3O5S |
| Molecular Weight | 688.81 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | 2,3-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenyl-9H-fluorene;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)Oc1ccc(-c2cc3c(c(-c4ccccc4)c2-c2ccc(OC(C)(C)C)cc2)Cc2ccccc2-3)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C39H38O2.CHF3O3S/c1-38(2,3)40-30-20-16-26(17-21-30)33-25-34-32-15-11-10-14-29(32)24-35(34)37(27-12-8-7-9-13-27)36(33)28-18-22-31(23-19-28)41-39(4,5)6;2-1(3,4)8(5,6)7/h7-23,25H,24H2,1-6H3;(H,5,6,7) |
| InChIKey | AVXBWKOMHYNOJL-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.81 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|