C28H26Cl2F3NO6S — CID 157247325
2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxylic acid;methyl 4-(1-aminocyclopropyl)benzoate;oxalyl dichloride (PubChem CID 157247325) has the molecular formula C28H26Cl2F3NO6S and a molecular weight of 632.48 g/mol. Its IUPAC name is 2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxylic acid;methyl 4-(1-aminocyclopropyl)benzoate;oxalyl dichloride.
| Compound Name | 2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxylic acid;methyl 4-(1-aminocyclopropyl)benzoate;oxalyl dichloride |
|---|---|
| PubChem CID | 157247325 |
| Molecular Formula | C28H26Cl2F3NO6S |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | 2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxylic acid;methyl 4-(1-aminocyclopropyl)benzoate;oxalyl dichloride |
| SMILES | COC(=O)c1ccc(C2(N)CC2)cc1.Cc1sc(C)c(C(=O)O)c1Cc1ccc(C(F)(F)F)cc1.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C15H13F3O2S.C11H13NO2.C2Cl2O2/c1-8-12(13(14(19)20)9(2)21-8)7-10-3-5-11(6-4-10)15(16,17)18;1-14-10(13)8-2-4-9(5-3-8)11(12)6-7-11;3-1(5)2(4)6/h3-6H,7H2,1-2H3,(H,19,20);2-5H,6-7,12H2,1H3; |
| InChIKey | AVXWYPIIZAIAKW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|