C25H21F3NNaO3S — CID 175647729
sodium N-[1-(4-carboxyphenyl)cyclopropyl]-2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboximidate (PubChem CID 175647729) has the molecular formula C25H21F3NNaO3S and a molecular weight of 495.50 g/mol. Its IUPAC name is sodium N-[1-(4-carboxyphenyl)cyclopropyl]-2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboximidate.
| Compound Name | sodium N-[1-(4-carboxyphenyl)cyclopropyl]-2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboximidate |
|---|---|
| PubChem CID | 175647729 |
| Molecular Formula | C25H21F3NNaO3S |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | sodium N-[1-(4-carboxyphenyl)cyclopropyl]-2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carboximidate |
| SMILES | Cc1sc(C)c(/C([O-])=N/C2(c3ccc(C(=O)O)cc3)CC2)c1Cc1ccc(C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C25H22F3NO3S.Na/c1-14-20(13-16-3-7-19(8-4-16)25(26,27)28)21(15(2)33-14)22(30)29-24(11-12-24)18-9-5-17(6-10-18)23(31)32;/h3-10H,11-13H2,1-2H3,(H,29,30)(H,31,32);/q;+1/p-1 |
| InChIKey | RQRUUNKVGDVBFV-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|