About trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate
trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate (PubChem CID 15725603) has the molecular formula C61H51NO3
and a molecular weight of 846.08 g/mol. Its IUPAC name is trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate.
Molecular Properties
| Compound Name | trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate |
| PubChem CID | 15725603 |
| Molecular Formula | C61H51NO3 |
| Molecular Weight | 846.08 g/mol |
| Exact Mass | 845.39 |
| IUPAC Name | trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate |
| SMILES | C[C@@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C61H51NO3/c1-47(64-60(51-35-17-5-18-36-51,52-37-19-6-20-38-52)53-39-21-7-22-40-53)57(62-59(48-29-11-2-12-30-48,49-31-13-3-14-32-49)50-33-15-4-16-34-50)58(63)65-61(54-41-23-8-24-42-54,55-43-25-9-26-44-55)56-45-27-10-28-46-56/h2-47,57,62H,1H3/t47-,57+/m1/s1 |
| InChIKey | PJUPADIBNKAGTR-PMIWBHDMSA-N |
| XLogP | 12.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 846.08 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate?
The IUPAC name of trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate (CID 15725603) is trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate.
What is the SMILES notation for trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate?
The canonical SMILES for trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate is C[C@@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate?
The InChIKey is PJUPADIBNKAGTR-PMIWBHDMSA-N. The full InChI is InChI=1S/C61H51NO3/c1-47(64-60(51-35-17-5-18-36-51,52-37-19-6-20-38-52)53-39-21-7-22-40-53)57(62-59(48-29-11-2-12-30-48,49-31-13-3-14-32-49)50-33-15-4-16-34-50)58(63)65-61(54-41-23-8-24-42-54,55-43-25-9-26-44-55)56-45-27-10-28-46-56/h2-47,57,62H,1H3/t47-,57+/m1/s1.
What are the key properties of trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate?
trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate has a molecular weight of 846.08 g/mol, XLogP of 12.87, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trityl (2S,3R)-2-(tritylamino)-3-trityloxybutanoate is sourced from PubChem (CID 15725603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).