C48H47F3NO7P — CID 18611186
[(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] 4,4,4-trifluoro-3-methylbutanoate (PubChem CID 18611186) has the molecular formula C48H47F3NO7P and a molecular weight of 837.87 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] 4,4,4-trifluoro-3-methylbutanoate.
| Compound Name | [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] 4,4,4-trifluoro-3-methylbutanoate |
|---|---|
| PubChem CID | 18611186 |
| Molecular Formula | C48H47F3NO7P |
| Molecular Weight | 837.87 g/mol |
| Exact Mass | 837.30 |
| IUPAC Name | [(2R)-1-[hydroxy-[2-(tritylamino)ethoxy]phosphoryl]oxy-3-trityloxypropan-2-yl] 4,4,4-trifluoro-3-methylbutanoate |
| SMILES | CC(CC(=O)O[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)COP(=O)(O)OCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C48H47F3NO7P/c1-37(48(49,50)51)34-45(53)59-44(35-56-47(41-26-14-5-15-27-41,42-28-16-6-17-29-42)43-30-18-7-19-31-43)36-58-60(54,55)57-33-32-52-46(38-20-8-2-9-21-38,39-22-10-3-11-23-39)40-24-12-4-13-25-40/h2-31,37,44,52H,32-36H2,1H3,(H,54,55)/t37?,44-/m1/s1 |
| InChIKey | JYTLUQUWUZYFNW-YGFZUFCPSA-N |
| XLogP | 10.21 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.87 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|